About 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid
5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 3161121) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid.
Analyze 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid (CID 3161121) is 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid is Cc1nn(C)cc1-c1cc(C(=O)O)no1.
What is the InChIKey of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is POAACBFRLKLYDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c1-5-6(4-12(2)10-5)8-3-7(9(13)14)11-15-8/h3-4H,1-2H3,(H,13,14).
What are the key properties of 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid?
5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 207.19 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 3161121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).