C10H15FN4O — CID 118936849
6-fluoro-2-(1-methylpiperidin-3-yl)oxypyrimidin-4-amine (PubChem CID 118936849) has the molecular formula C10H15FN4O and a molecular weight of 226.25 g/mol. Its IUPAC name is 6-fluoro-2-(1-methylpiperidin-3-yl)oxypyrimidin-4-amine.
| Compound Name | 6-fluoro-2-(1-methylpiperidin-3-yl)oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 118936849 |
| Molecular Formula | C10H15FN4O |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 6-fluoro-2-(1-methylpiperidin-3-yl)oxypyrimidin-4-amine |
| SMILES | CN1CCCC(Oc2nc(N)cc(F)n2)C1 |
| InChI | InChI=1S/C10H15FN4O/c1-15-4-2-3-7(6-15)16-10-13-8(11)5-9(12)14-10/h5,7H,2-4,6H2,1H3,(H2,12,13,14) |
| InChIKey | WSPZDDYKUFPBGO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |