C9H13FN4O — CID 118936944
6-fluoro-2-[(3R)-1-methylpyrrolidin-3-yl]oxypyrimidin-4-amine (PubChem CID 118936944) has the molecular formula C9H13FN4O and a molecular weight of 212.23 g/mol. Its IUPAC name is 6-fluoro-2-[(3R)-1-methylpyrrolidin-3-yl]oxypyrimidin-4-amine.
| Compound Name | 6-fluoro-2-[(3R)-1-methylpyrrolidin-3-yl]oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 118936944 |
| Molecular Formula | C9H13FN4O |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 6-fluoro-2-[(3R)-1-methylpyrrolidin-3-yl]oxypyrimidin-4-amine |
| SMILES | CN1CC[C@@H](Oc2nc(N)cc(F)n2)C1 |
| InChI | InChI=1S/C9H13FN4O/c1-14-3-2-6(5-14)15-9-12-7(10)4-8(11)13-9/h4,6H,2-3,5H2,1H3,(H2,11,12,13)/t6-/m1/s1 |
| InChIKey | BZNBGRZOZXDDPU-ZCFIWIBFSA-N |
| XLogP | 0.28 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |