C22H31FN4O3 — CID 118939319
2-(2,2-dimethoxyethylamino)-4-(3-ethyl-6,6-dimethyl-5,7-dihydro-4H-indazol-1-yl)-6-fluorobenzamide (PubChem CID 118939319) has the molecular formula C22H31FN4O3 and a molecular weight of 418.51 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylamino)-4-(3-ethyl-6,6-dimethyl-5,7-dihydro-4H-indazol-1-yl)-6-fluorobenzamide.
| Compound Name | 2-(2,2-dimethoxyethylamino)-4-(3-ethyl-6,6-dimethyl-5,7-dihydro-4H-indazol-1-yl)-6-fluorobenzamide |
|---|---|
| PubChem CID | 118939319 |
| Molecular Formula | C22H31FN4O3 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 2-(2,2-dimethoxyethylamino)-4-(3-ethyl-6,6-dimethyl-5,7-dihydro-4H-indazol-1-yl)-6-fluorobenzamide |
| SMILES | CCc1nn(-c2cc(F)c(C(N)=O)c(NCC(OC)OC)c2)c2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C22H31FN4O3/c1-6-16-14-7-8-22(2,3)11-18(14)27(26-16)13-9-15(23)20(21(24)28)17(10-13)25-12-19(29-4)30-5/h9-10,19,25H,6-8,11-12H2,1-5H3,(H2,24,28) |
| InChIKey | YEDIBRCYOPRLRY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|