C23H29FN4O — CID 118939674
2-(cyclohexylamino)-6-fluoro-4-(3,6,6-trimethyl-7H-indazol-1-yl)benzamide (PubChem CID 118939674) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-(cyclohexylamino)-6-fluoro-4-(3,6,6-trimethyl-7H-indazol-1-yl)benzamide.
| Compound Name | 2-(cyclohexylamino)-6-fluoro-4-(3,6,6-trimethyl-7H-indazol-1-yl)benzamide |
|---|---|
| PubChem CID | 118939674 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-(cyclohexylamino)-6-fluoro-4-(3,6,6-trimethyl-7H-indazol-1-yl)benzamide |
| SMILES | Cc1nn(-c2cc(F)c(C(N)=O)c(NC3CCCCC3)c2)c2c1C=CC(C)(C)C2 |
| InChI | InChI=1S/C23H29FN4O/c1-14-17-9-10-23(2,3)13-20(17)28(27-14)16-11-18(24)21(22(25)29)19(12-16)26-15-7-5-4-6-8-15/h9-12,15,26H,4-8,13H2,1-3H3,(H2,25,29) |
| InChIKey | RTKKNKWOFBAPPR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |