C25H32FN5O4 — CID 68720978
cyclopentyl 2-amino-2-[2-carbamoyl-5-(3-ethyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-3-fluoroanilino]acetate (PubChem CID 68720978) has the molecular formula C25H32FN5O4 and a molecular weight of 485.56 g/mol. Its IUPAC name is cyclopentyl 2-amino-2-[2-carbamoyl-5-(3-ethyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-3-fluoroanilino]acetate.
| Compound Name | cyclopentyl 2-amino-2-[2-carbamoyl-5-(3-ethyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-3-fluoroanilino]acetate |
|---|---|
| PubChem CID | 68720978 |
| Molecular Formula | C25H32FN5O4 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | cyclopentyl 2-amino-2-[2-carbamoyl-5-(3-ethyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-3-fluoroanilino]acetate |
| SMILES | CCc1nn(-c2cc(F)c(C(N)=O)c(NC(N)C(=O)OC3CCCC3)c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C25H32FN5O4/c1-4-16-21-18(11-25(2,3)12-19(21)32)31(30-16)13-9-15(26)20(23(28)33)17(10-13)29-22(27)24(34)35-14-7-5-6-8-14/h9-10,14,22,29H,4-8,11-12,27H2,1-3H3,(H2,28,33) |
| InChIKey | KTFPKZOIJHGIIH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 142.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|