C30H44N4O4 — CID 143863399
4-[3-[6-(hydroxyamino)-6-oxohexyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl]-2-methylbenzamide;methylcyclohexane (PubChem CID 143863399) has the molecular formula C30H44N4O4 and a molecular weight of 524.71 g/mol. Its IUPAC name is 4-[3-[6-(hydroxyamino)-6-oxohexyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl]-2-methylbenzamide;methylcyclohexane.
| Compound Name | 4-[3-[6-(hydroxyamino)-6-oxohexyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl]-2-methylbenzamide;methylcyclohexane |
|---|---|
| PubChem CID | 143863399 |
| Molecular Formula | C30H44N4O4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | 4-[3-[6-(hydroxyamino)-6-oxohexyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl]-2-methylbenzamide;methylcyclohexane |
| SMILES | CC1CCCCC1.Cc1cc(-n2nc(CCCCCC(=O)NO)c3c2CC(C)(C)CC3=O)ccc1C(N)=O |
| InChI | InChI=1S/C23H30N4O4.C7H14/c1-14-11-15(9-10-16(14)22(24)30)27-18-12-23(2,3)13-19(28)21(18)17(25-27)7-5-4-6-8-20(29)26-31;1-7-5-3-2-4-6-7/h9-11,31H,4-8,12-13H2,1-3H3,(H2,24,30)(H,26,29);7H,2-6H2,1H3 |
| InChIKey | SHTPFKJXVRJONG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|