C24H32N4O4 — CID 143863392
7-[2-formyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)anilino]-N-hydroxyheptanamide (PubChem CID 143863392) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 7-[2-formyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)anilino]-N-hydroxyheptanamide.
| Compound Name | 7-[2-formyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)anilino]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 143863392 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 7-[2-formyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)anilino]-N-hydroxyheptanamide |
| SMILES | Cc1nn(-c2ccc(C=O)c(NCCCCCCC(=O)NO)c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C24H32N4O4/c1-16-23-20(13-24(2,3)14-21(23)30)28(26-16)18-10-9-17(15-29)19(12-18)25-11-7-5-4-6-8-22(31)27-32/h9-10,12,15,25,32H,4-8,11,13-14H2,1-3H3,(H,27,31) |
| InChIKey | CXEQBGOAOYWIFQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|