C21H28N4O3 — CID 66952874
2-(3-methoxypropylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide (PubChem CID 66952874) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(3-methoxypropylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide.
| Compound Name | 2-(3-methoxypropylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
|---|---|
| PubChem CID | 66952874 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 2-(3-methoxypropylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
| SMILES | COCCCNc1cc(-n2nc(C)c3c2CC(C)(C)CC3=O)ccc1C(N)=O |
| InChI | InChI=1S/C21H28N4O3/c1-13-19-17(11-21(2,3)12-18(19)26)25(24-13)14-6-7-15(20(22)27)16(10-14)23-8-5-9-28-4/h6-7,10,23H,5,8-9,11-12H2,1-4H3,(H2,22,27) |
| InChIKey | UKFAPGAMHHPEBT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|