C38H52IN5O9 — CID 130347057
[1-amino-3-[2-[2-[2-[2-[3-[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)anilino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl] 3-iodobenzoate (PubChem CID 130347057) has the molecular formula C38H52IN5O9 and a molecular weight of 849.76 g/mol. Its IUPAC name is [1-amino-3-[2-[2-[2-[2-[3-[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)anilino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl] 3-iodobenzoate.
| Compound Name | [1-amino-3-[2-[2-[2-[2-[3-[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)anilino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl] 3-iodobenzoate |
|---|---|
| PubChem CID | 130347057 |
| Molecular Formula | C38H52IN5O9 |
| Molecular Weight | 849.76 g/mol |
| Exact Mass | 849.28 |
| IUPAC Name | [1-amino-3-[2-[2-[2-[2-[3-[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)anilino]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl] 3-iodobenzoate |
| SMILES | Cc1nn(-c2ccc(C(N)=O)c(NCCCOCCOCCOCCOCCOCCC(N)OC(=O)c3cccc(I)c3)c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C38H52IN5O9/c1-26-35-32(24-38(2,3)25-33(35)45)44(43-26)29-8-9-30(36(41)46)31(23-29)42-11-5-12-48-14-16-50-18-20-52-21-19-51-17-15-49-13-10-34(40)53-37(47)27-6-4-7-28(39)22-27/h4,6-9,22-23,34,42H,5,10-21,24-25,40H2,1-3H3,(H2,41,46) |
| InChIKey | BCHAORHIJSQKLH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 188.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.76 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|