C30H37N5O4 — CID 118728492
2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide (PubChem CID 118728492) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is 2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide.
| Compound Name | 2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
|---|---|
| PubChem CID | 118728492 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 2-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
| SMILES | COc1cc2c(cc1OC)CN(CCNc1cc(-n3nc(C)c4c3CC(C)(C)CC4=O)ccc1C(N)=O)CC2 |
| InChI | InChI=1S/C30H37N5O4/c1-18-28-24(15-30(2,3)16-25(28)36)35(33-18)21-6-7-22(29(31)37)23(14-21)32-9-11-34-10-8-19-12-26(38-4)27(39-5)13-20(19)17-34/h6-7,12-14,32H,8-11,15-17H2,1-5H3,(H2,31,37) |
| InChIKey | PSLDQXGRCCSOAZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |