C19H22FN5O4 — CID 130348186
1-[4-carbamoyl-3-(3-methoxypropylamino)phenyl]-3-methyl-4-oxo-5,7-dihydropyrazolo[5,4-c]pyridine-6-carbonyl fluoride (PubChem CID 130348186) has the molecular formula C19H22FN5O4 and a molecular weight of 403.41 g/mol. Its IUPAC name is 1-[4-carbamoyl-3-(3-methoxypropylamino)phenyl]-3-methyl-4-oxo-5,7-dihydropyrazolo[5,4-c]pyridine-6-carbonyl fluoride.
| Compound Name | 1-[4-carbamoyl-3-(3-methoxypropylamino)phenyl]-3-methyl-4-oxo-5,7-dihydropyrazolo[5,4-c]pyridine-6-carbonyl fluoride |
|---|---|
| PubChem CID | 130348186 |
| Molecular Formula | C19H22FN5O4 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[4-carbamoyl-3-(3-methoxypropylamino)phenyl]-3-methyl-4-oxo-5,7-dihydropyrazolo[5,4-c]pyridine-6-carbonyl fluoride |
| SMILES | COCCCNc1cc(-n2nc(C)c3c2CN(C(=O)F)CC3=O)ccc1C(N)=O |
| InChI | InChI=1S/C19H22FN5O4/c1-11-17-15(9-24(19(20)28)10-16(17)26)25(23-11)12-4-5-13(18(21)27)14(8-12)22-6-3-7-29-2/h4-5,8,22H,3,6-7,9-10H2,1-2H3,(H2,21,27) |
| InChIKey | BGZCCPBSQTVKDN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|