C22H25N3O3 — CID 145160030
2-(2-methoxyethylamino)-4-(4-oxo-2,3,6,7-tetrahydro-1H-carbazol-9-yl)benzamide (PubChem CID 145160030) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-4-(4-oxo-2,3,6,7-tetrahydro-1H-carbazol-9-yl)benzamide.
| Compound Name | 2-(2-methoxyethylamino)-4-(4-oxo-2,3,6,7-tetrahydro-1H-carbazol-9-yl)benzamide |
|---|---|
| PubChem CID | 145160030 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-(2-methoxyethylamino)-4-(4-oxo-2,3,6,7-tetrahydro-1H-carbazol-9-yl)benzamide |
| SMILES | COCCNc1cc(-n2c3c(c4c2=CCCC=4)C(=O)CCC3)ccc1C(N)=O |
| InChI | InChI=1S/C22H25N3O3/c1-28-12-11-24-17-13-14(9-10-15(17)22(23)27)25-18-6-3-2-5-16(18)21-19(25)7-4-8-20(21)26/h5-6,9-10,13,24H,2-4,7-8,11-12H2,1H3,(H2,23,27) |
| InChIKey | UHXWTKJLHHIVEU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|