C25H27N3O5 — CID 66952445
4-(2-methyl-4-oxo-6,7-dihydro-5H-indol-1-yl)-2-(3,4,5-trimethoxyanilino)benzamide (PubChem CID 66952445) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-(2-methyl-4-oxo-6,7-dihydro-5H-indol-1-yl)-2-(3,4,5-trimethoxyanilino)benzamide.
| Compound Name | 4-(2-methyl-4-oxo-6,7-dihydro-5H-indol-1-yl)-2-(3,4,5-trimethoxyanilino)benzamide |
|---|---|
| PubChem CID | 66952445 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-(2-methyl-4-oxo-6,7-dihydro-5H-indol-1-yl)-2-(3,4,5-trimethoxyanilino)benzamide |
| SMILES | COc1cc(Nc2cc(-n3c(C)cc4c3CCCC4=O)ccc2C(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H27N3O5/c1-14-10-18-20(6-5-7-21(18)29)28(14)16-8-9-17(25(26)30)19(13-16)27-15-11-22(31-2)24(33-4)23(12-15)32-3/h8-13,27H,5-7H2,1-4H3,(H2,26,30) |
| InChIKey | CRGABWNOCHJGKX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|