C39H37N3O — CID 118941666
(E)-1-cyclohexyl-3-[6-cyclopropyl-3-(1-tritylimidazol-4-yl)-2-pyridinyl]prop-2-en-1-one (PubChem CID 118941666) has the molecular formula C39H37N3O and a molecular weight of 563.75 g/mol. Its IUPAC name is (E)-1-cyclohexyl-3-[6-cyclopropyl-3-(1-tritylimidazol-4-yl)-2-pyridinyl]prop-2-en-1-one.
| Compound Name | (E)-1-cyclohexyl-3-[6-cyclopropyl-3-(1-tritylimidazol-4-yl)-2-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118941666 |
| Molecular Formula | C39H37N3O |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | (E)-1-cyclohexyl-3-[6-cyclopropyl-3-(1-tritylimidazol-4-yl)-2-pyridinyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1nc(C2CC2)ccc1-c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C1CCCCC1 |
| InChI | InChI=1S/C39H37N3O/c43-38(30-13-5-1-6-14-30)26-25-36-34(23-24-35(41-36)29-21-22-29)37-27-42(28-40-37)39(31-15-7-2-8-16-31,32-17-9-3-10-18-32)33-19-11-4-12-20-33/h2-4,7-12,15-20,23-30H,1,5-6,13-14,21-22H2/b26-25+ |
| InChIKey | OTSMPVUMJHYZRK-OCEACIFDSA-N |
| XLogP | 8.83 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|