C37H35N3O2 — CID 118917114
(E)-1-cyclohexyl-3-[2-methoxy-5-(1-tritylimidazol-4-yl)-4-pyridinyl]prop-2-en-1-one (PubChem CID 118917114) has the molecular formula C37H35N3O2 and a molecular weight of 553.71 g/mol. Its IUPAC name is (E)-1-cyclohexyl-3-[2-methoxy-5-(1-tritylimidazol-4-yl)-4-pyridinyl]prop-2-en-1-one.
| Compound Name | (E)-1-cyclohexyl-3-[2-methoxy-5-(1-tritylimidazol-4-yl)-4-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118917114 |
| Molecular Formula | C37H35N3O2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | (E)-1-cyclohexyl-3-[2-methoxy-5-(1-tritylimidazol-4-yl)-4-pyridinyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)C2CCCCC2)c(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)cn1 |
| InChI | InChI=1S/C37H35N3O2/c1-42-36-24-29(22-23-35(41)28-14-6-2-7-15-28)33(25-38-36)34-26-40(27-39-34)37(30-16-8-3-9-17-30,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h3-5,8-13,16-28H,2,6-7,14-15H2,1H3/b23-22+ |
| InChIKey | VXAVYBVNDQBJHC-GHVJWSGMSA-N |
| XLogP | 7.96 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|