C49H43N5O2 — CID 122498748
1-(4-cyanophenyl)-3-[4-[(E)-3-[2-(1-tritylimidazol-4-yl)phenyl]prop-2-enoyl]-1-adamantyl]urea (PubChem CID 122498748) has the molecular formula C49H43N5O2 and a molecular weight of 733.92 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[4-[(E)-3-[2-(1-tritylimidazol-4-yl)phenyl]prop-2-enoyl]-1-adamantyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[4-[(E)-3-[2-(1-tritylimidazol-4-yl)phenyl]prop-2-enoyl]-1-adamantyl]urea |
|---|---|
| PubChem CID | 122498748 |
| Molecular Formula | C49H43N5O2 |
| Molecular Weight | 733.92 g/mol |
| Exact Mass | 733.34 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[4-[(E)-3-[2-(1-tritylimidazol-4-yl)phenyl]prop-2-enoyl]-1-adamantyl]urea |
| SMILES | N#Cc1ccc(NC(=O)NC23CC4CC(C2)C(C(=O)/C=C/c2ccccc2-c2cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)cn2)C(C4)C3)cc1 |
| InChI | InChI=1S/C49H43N5O2/c50-31-34-20-23-42(24-21-34)52-47(56)53-48-28-35-26-37(29-48)46(38(27-35)30-48)45(55)25-22-36-12-10-11-19-43(36)44-32-54(33-51-44)49(39-13-4-1-5-14-39,40-15-6-2-7-16-40)41-17-8-3-9-18-41/h1-25,32-33,35,37-38,46H,26-30H2,(H2,52,53,56)/b25-22+ |
| InChIKey | BZJCJRQCCCKOEO-YYDJUVGSSA-N |
| XLogP | 9.86 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.92 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|