C33H30BrN3O — CID 162788032
5-bromo-N-[4-(1-tritylimidazol-4-yl)phenyl]pentanamide (PubChem CID 162788032) has the molecular formula C33H30BrN3O and a molecular weight of 564.53 g/mol. Its IUPAC name is 5-bromo-N-[4-(1-tritylimidazol-4-yl)phenyl]pentanamide.
| Compound Name | 5-bromo-N-[4-(1-tritylimidazol-4-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 162788032 |
| Molecular Formula | C33H30BrN3O |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | 5-bromo-N-[4-(1-tritylimidazol-4-yl)phenyl]pentanamide |
| SMILES | O=C(CCCCBr)Nc1ccc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C33H30BrN3O/c34-23-11-10-18-32(38)36-30-21-19-26(20-22-30)31-24-37(25-35-31)33(27-12-4-1-5-13-27,28-14-6-2-7-15-28)29-16-8-3-9-17-29/h1-9,12-17,19-22,24-25H,10-11,18,23H2,(H,36,38) |
| InChIKey | ADUBOLZJCNJLFR-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|