C36H31ClN2O2 — CID 118941687
(E)-3-[2-chloro-6-(1-tritylimidazol-4-yl)phenyl]-1-(oxan-4-yl)prop-2-en-1-one (PubChem CID 118941687) has the molecular formula C36H31ClN2O2 and a molecular weight of 559.11 g/mol. Its IUPAC name is (E)-3-[2-chloro-6-(1-tritylimidazol-4-yl)phenyl]-1-(oxan-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-chloro-6-(1-tritylimidazol-4-yl)phenyl]-1-(oxan-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118941687 |
| Molecular Formula | C36H31ClN2O2 |
| Molecular Weight | 559.11 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | (E)-3-[2-chloro-6-(1-tritylimidazol-4-yl)phenyl]-1-(oxan-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(Cl)cccc1-c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C1CCOCC1 |
| InChI | InChI=1S/C36H31ClN2O2/c37-33-18-10-17-32(31(33)19-20-35(40)27-21-23-41-24-22-27)34-25-39(26-38-34)36(28-11-4-1-5-12-28,29-13-6-2-7-14-29)30-15-8-3-9-16-30/h1-20,25-27H,21-24H2/b20-19+ |
| InChIKey | QKSUIXFOWYUHOG-FMQUCBEESA-N |
| XLogP | 8.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.11 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|