C39H28N4O — CID 175796652
8-oxo-7-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-5,6-dihydroquinoline-3-carbonitrile (PubChem CID 175796652) has the molecular formula C39H28N4O and a molecular weight of 568.68 g/mol. Its IUPAC name is 8-oxo-7-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-5,6-dihydroquinoline-3-carbonitrile.
| Compound Name | 8-oxo-7-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-5,6-dihydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 175796652 |
| Molecular Formula | C39H28N4O |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 8-oxo-7-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-5,6-dihydroquinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2c(c1)CCC(=Cc1ccccc1-c1cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn1)C2=O |
| InChI | InChI=1S/C39H28N4O/c40-24-28-22-30-20-21-31(38(44)37(30)41-25-28)23-29-12-10-11-19-35(29)36-26-43(27-42-36)39(32-13-4-1-5-14-32,33-15-6-2-7-16-33)34-17-8-3-9-18-34/h1-19,22-23,25-27H,20-21H2 |
| InChIKey | ORUABMVJPDNNAH-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|