C37H29FN4O — CID 137406197
2-(fluoromethyl)-5-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-6,7-dihydropyrazolo[1,5-a]pyridin-4-one (PubChem CID 137406197) has the molecular formula C37H29FN4O and a molecular weight of 564.66 g/mol. Its IUPAC name is 2-(fluoromethyl)-5-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-6,7-dihydropyrazolo[1,5-a]pyridin-4-one.
| Compound Name | 2-(fluoromethyl)-5-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-6,7-dihydropyrazolo[1,5-a]pyridin-4-one |
|---|---|
| PubChem CID | 137406197 |
| Molecular Formula | C37H29FN4O |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 2-(fluoromethyl)-5-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-6,7-dihydropyrazolo[1,5-a]pyridin-4-one |
| SMILES | O=C1C(=Cc2ccccc2-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)CCn2nc(CF)cc21 |
| InChI | InChI=1S/C37H29FN4O/c38-24-32-23-35-36(43)28(20-21-42(35)40-32)22-27-12-10-11-19-33(27)34-25-41(26-39-34)37(29-13-4-1-5-14-29,30-15-6-2-7-16-30)31-17-8-3-9-18-31/h1-19,22-23,25-26H,20-21,24H2 |
| InChIKey | HHXWFOBXTDXEDM-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|