C36H27ClN4O — CID 137406126
3-chloro-5-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-6,7-dihydropyrazolo[1,5-a]pyridin-4-one (PubChem CID 137406126) has the molecular formula C36H27ClN4O and a molecular weight of 567.09 g/mol. Its IUPAC name is 3-chloro-5-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-6,7-dihydropyrazolo[1,5-a]pyridin-4-one.
| Compound Name | 3-chloro-5-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-6,7-dihydropyrazolo[1,5-a]pyridin-4-one |
|---|---|
| PubChem CID | 137406126 |
| Molecular Formula | C36H27ClN4O |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 3-chloro-5-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-6,7-dihydropyrazolo[1,5-a]pyridin-4-one |
| SMILES | O=C1C(=Cc2ccccc2-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)CCn2ncc(Cl)c21 |
| InChI | InChI=1S/C36H27ClN4O/c37-32-23-39-41-21-20-27(35(42)34(32)41)22-26-12-10-11-19-31(26)33-24-40(25-38-33)36(28-13-4-1-5-14-28,29-15-6-2-7-16-29)30-17-8-3-9-18-30/h1-19,22-25H,20-21H2 |
| InChIKey | PDQYUXUSWCPGRU-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|