C39H31N3O3S — CID 137406238
(7E)-8-oxo-7-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-5,6-dihydronaphthalene-2-sulfonamide (PubChem CID 137406238) has the molecular formula C39H31N3O3S and a molecular weight of 621.76 g/mol. Its IUPAC name is (7E)-8-oxo-7-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-5,6-dihydronaphthalene-2-sulfonamide.
| Compound Name | (7E)-8-oxo-7-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-5,6-dihydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 137406238 |
| Molecular Formula | C39H31N3O3S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | (7E)-8-oxo-7-[[2-(1-tritylimidazol-4-yl)phenyl]methylidene]-5,6-dihydronaphthalene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)C(=O)/C(=C/c1ccccc1-c1cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn1)CC2 |
| InChI | InChI=1S/C39H31N3O3S/c40-46(44,45)34-23-22-28-20-21-30(38(43)36(28)25-34)24-29-12-10-11-19-35(29)37-26-42(27-41-37)39(31-13-4-1-5-14-31,32-15-6-2-7-16-32)33-17-8-3-9-18-33/h1-19,22-27H,20-21H2,(H2,40,44,45)/b30-24+ |
| InChIKey | UQALLNNHLGBWPC-BGABXYSRSA-N |
| XLogP | 7.25 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|