C18H15N5O2S — CID 145337940
(5E)-5-[[2-(1-aminoimidazol-4-yl)phenyl]methylidene]-4-oxo-6,7-dihydro-1,3-benzothiazole-2-carboxamide (PubChem CID 145337940) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is (5E)-5-[[2-(1-aminoimidazol-4-yl)phenyl]methylidene]-4-oxo-6,7-dihydro-1,3-benzothiazole-2-carboxamide.
| Compound Name | (5E)-5-[[2-(1-aminoimidazol-4-yl)phenyl]methylidene]-4-oxo-6,7-dihydro-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 145337940 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (5E)-5-[[2-(1-aminoimidazol-4-yl)phenyl]methylidene]-4-oxo-6,7-dihydro-1,3-benzothiazole-2-carboxamide |
| SMILES | NC(=O)c1nc2c(s1)CC/C(=C\c1ccccc1-c1cn(N)cn1)C2=O |
| InChI | InChI=1S/C18H15N5O2S/c19-17(25)18-22-15-14(26-18)6-5-11(16(15)24)7-10-3-1-2-4-12(10)13-8-23(20)9-21-13/h1-4,7-9H,5-6,20H2,(H2,19,25)/b11-7+ |
| InChIKey | GGTITVULBJEGOH-YRNVUSSQSA-N |
| XLogP | 2.03 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|