C47H38N4O2S — CID 70030019
(3R,5Z)-2-(benzenesulfonyl)-3-benzyl-5-[(1-tritylimidazol-4-yl)methylidene]-3,4-dihydro-1H-2-benzazepine-8-carbonitrile (PubChem CID 70030019) has the molecular formula C47H38N4O2S and a molecular weight of 722.91 g/mol. Its IUPAC name is (3R,5Z)-2-(benzenesulfonyl)-3-benzyl-5-[(1-tritylimidazol-4-yl)methylidene]-3,4-dihydro-1H-2-benzazepine-8-carbonitrile.
| Compound Name | (3R,5Z)-2-(benzenesulfonyl)-3-benzyl-5-[(1-tritylimidazol-4-yl)methylidene]-3,4-dihydro-1H-2-benzazepine-8-carbonitrile |
|---|---|
| PubChem CID | 70030019 |
| Molecular Formula | C47H38N4O2S |
| Molecular Weight | 722.91 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | (3R,5Z)-2-(benzenesulfonyl)-3-benzyl-5-[(1-tritylimidazol-4-yl)methylidene]-3,4-dihydro-1H-2-benzazepine-8-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CN(S(=O)(=O)c1ccccc1)[C@H](Cc1ccccc1)C/C2=C/c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C47H38N4O2S/c48-32-37-26-27-46-38(31-44(29-36-16-6-1-7-17-36)51(33-39(46)28-37)54(52,53)45-24-14-5-15-25-45)30-43-34-50(35-49-43)47(40-18-8-2-9-19-40,41-20-10-3-11-21-41)42-22-12-4-13-23-42/h1-28,30,34-35,44H,29,31,33H2/b38-30-/t44-/m1/s1 |
| InChIKey | OMSZFVINUGAIOP-QNSXNRRMSA-N |
| XLogP | 9.34 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.91 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|