About 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one
10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one (PubChem CID 118943952) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one.
Analyze 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one?
The IUPAC name of 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one (CID 118943952) is 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one.
What is the SMILES notation for 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one?
The canonical SMILES for 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one is CN1C(=O)C2C3CC(C4CCCCC43)C21.
What is the InChIKey of 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one?
The InChIKey is WEFYFGBMSAJNNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-14-12-10-6-9(11(12)13(14)15)7-4-2-3-5-8(7)10/h7-12H,2-6H2,1H3.
What are the key properties of 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one?
10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one has a molecular weight of 205.30 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-10-azatetracyclo[6.4.1.02,7.09,12]tridecan-11-one is sourced from PubChem (CID 118943952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).