C30H51N3O5 — CID 118944132
[(4R)-11-[(4S,5R,6R)-5-(hydroxymethyl)-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),11-dien-10-yl]-2-oxoundecan-4-yl] (3R)-3-methoxyoctanoate (PubChem CID 118944132) has the molecular formula C30H51N3O5 and a molecular weight of 533.75 g/mol. Its IUPAC name is [(4R)-11-[(4S,5R,6R)-5-(hydroxymethyl)-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),11-dien-10-yl]-2-oxoundecan-4-yl] (3R)-3-methoxyoctanoate.
| Compound Name | [(4R)-11-[(4S,5R,6R)-5-(hydroxymethyl)-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),11-dien-10-yl]-2-oxoundecan-4-yl] (3R)-3-methoxyoctanoate |
|---|---|
| PubChem CID | 118944132 |
| Molecular Formula | C30H51N3O5 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.38 |
| IUPAC Name | [(4R)-11-[(4S,5R,6R)-5-(hydroxymethyl)-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),11-dien-10-yl]-2-oxoundecan-4-yl] (3R)-3-methoxyoctanoate |
| SMILES | CCCCC[C@H](CC(=O)O[C@H](CCCCCCCn1nnc2c1CC[C@H]1[C@@H](CO)[C@H]1CC2)CC(C)=O)OC |
| InChI | InChI=1S/C30H51N3O5/c1-4-5-9-12-23(37-3)20-30(36)38-24(19-22(2)35)13-10-7-6-8-11-18-33-29-17-15-26-25(27(26)21-34)14-16-28(29)31-32-33/h23-27,34H,4-21H2,1-3H3/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | NQIICURUQKHRJB-SEFGFODJSA-N |
| XLogP | 5.23 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|