C27H28FN5O6 — CID 118945574
1-[(4-fluorophenyl)methyl]-6-[4-(1,2-oxazol-3-yloxy)anilino]-3-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 118945574) has the molecular formula C27H28FN5O6 and a molecular weight of 537.55 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-6-[4-(1,2-oxazol-3-yloxy)anilino]-3-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-6-[4-(1,2-oxazol-3-yloxy)anilino]-3-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 118945574 |
| Molecular Formula | C27H28FN5O6 |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-6-[4-(1,2-oxazol-3-yloxy)anilino]-3-[(2,2,5-trimethyl-1,3-dioxan-5-yl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | CC1(Cn2c(=O)nc(Nc3ccc(Oc4ccon4)cc3)n(Cc3ccc(F)cc3)c2=O)COC(C)(C)OC1 |
| InChI | InChI=1S/C27H28FN5O6/c1-26(2)36-16-27(3,17-37-26)15-33-24(34)30-23(32(25(33)35)14-18-4-6-19(28)7-5-18)29-20-8-10-21(11-9-20)39-22-12-13-38-31-22/h4-13H,14-17H2,1-3H3,(H,29,30,34) |
| InChIKey | HMGMQXGUGADYAH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |