C24H21ClFN5O6 — CID 71610429
(2R,3S)-3-[3-[(4-chlorophenyl)methyl]-4-[3-fluoro-4-(1,2-oxazol-3-yloxy)anilino]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylbutanoic acid (PubChem CID 71610429) has the molecular formula C24H21ClFN5O6 and a molecular weight of 529.91 g/mol. Its IUPAC name is (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-4-[3-fluoro-4-(1,2-oxazol-3-yloxy)anilino]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylbutanoic acid.
| Compound Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-4-[3-fluoro-4-(1,2-oxazol-3-yloxy)anilino]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 71610429 |
| Molecular Formula | C24H21ClFN5O6 |
| Molecular Weight | 529.91 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-4-[3-fluoro-4-(1,2-oxazol-3-yloxy)anilino]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@H](C)n1c(=O)nc(Nc2ccc(Oc3ccon3)c(F)c2)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C24H21ClFN5O6/c1-13(21(32)33)14(2)31-23(34)28-22(30(24(31)35)12-15-3-5-16(25)6-4-15)27-17-7-8-19(18(26)11-17)37-20-9-10-36-29-20/h3-11,13-14H,12H2,1-2H3,(H,32,33)(H,27,28,34)/t13-,14+/m1/s1 |
| InChIKey | UYVSSGPTEVPHMM-KGLIPLIRSA-N |
| XLogP | 4.05 |
| TPSA | 141.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |