C25H26ClN5O4S — CID 130278364
(2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-propan-2-yl-1,3-benzothiazol-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid (PubChem CID 130278364) has the molecular formula C25H26ClN5O4S and a molecular weight of 528.03 g/mol. Its IUPAC name is (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-propan-2-yl-1,3-benzothiazol-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid.
| Compound Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-propan-2-yl-1,3-benzothiazol-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 130278364 |
| Molecular Formula | C25H26ClN5O4S |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-propan-2-yl-1,3-benzothiazol-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
| SMILES | CC(C)c1nc2ccc(Nc3nc(=O)n([C@@H](C)[C@@H](C)C(=O)O)c(=O)n3Cc3ccc(Cl)cc3)cc2s1 |
| InChI | InChI=1S/C25H26ClN5O4S/c1-13(2)21-28-19-10-9-18(11-20(19)36-21)27-23-29-24(34)31(15(4)14(3)22(32)33)25(35)30(23)12-16-5-7-17(26)8-6-16/h5-11,13-15H,12H2,1-4H3,(H,32,33)(H,27,29,34)/t14-,15+/m1/s1 |
| InChIKey | WFPBCAOBCJISEB-CABCVRRESA-N |
| XLogP | 4.87 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |