C24H23ClN4O5 — CID 161147395
(2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-oxo-1,3-dihydroinden-5-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid (PubChem CID 161147395) has the molecular formula C24H23ClN4O5 and a molecular weight of 482.92 g/mol. Its IUPAC name is (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-oxo-1,3-dihydroinden-5-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid.
| Compound Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-oxo-1,3-dihydroinden-5-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 161147395 |
| Molecular Formula | C24H23ClN4O5 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-oxo-1,3-dihydroinden-5-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@H](C)n1c(=O)nc(Nc2ccc3c(c2)CC(=O)C3)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C24H23ClN4O5/c1-13(21(31)32)14(2)29-23(33)27-22(26-19-8-5-16-10-20(30)11-17(16)9-19)28(24(29)34)12-15-3-6-18(25)7-4-15/h3-9,13-14H,10-12H2,1-2H3,(H,31,32)(H,26,27,33)/t13-,14+/m1/s1 |
| InChIKey | UOFUEZCYVRKFRA-KGLIPLIRSA-N |
| XLogP | 2.80 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |