C24H24ClN5O5 — CID 130279122
(2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid (PubChem CID 130279122) has the molecular formula C24H24ClN5O5 and a molecular weight of 497.94 g/mol. Its IUPAC name is (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid.
| Compound Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 130279122 |
| Molecular Formula | C24H24ClN5O5 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@H](C)n1c(=O)nc(Nc2ccc3c(c2)CCC(=O)N3)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C24H24ClN5O5/c1-13(21(32)33)14(2)30-23(34)28-22(29(24(30)35)12-15-3-6-17(25)7-4-15)26-18-8-9-19-16(11-18)5-10-20(31)27-19/h3-4,6-9,11,13-14H,5,10,12H2,1-2H3,(H,27,31)(H,32,33)(H,26,28,34)/t13-,14+/m1/s1 |
| InChIKey | HKTKCZVKGBKTPF-KGLIPLIRSA-N |
| XLogP | 3.02 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |