C28H29ClN4O5 — CID 130278202
(2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-(7,8,9,10-tetrahydro-6H-cyclohepta[b][1]benzofuran-2-ylamino)-1,3,5-triazin-1-yl]-2-methylbutanoic acid (PubChem CID 130278202) has the molecular formula C28H29ClN4O5 and a molecular weight of 537.02 g/mol. Its IUPAC name is (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-(7,8,9,10-tetrahydro-6H-cyclohepta[b][1]benzofuran-2-ylamino)-1,3,5-triazin-1-yl]-2-methylbutanoic acid.
| Compound Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-(7,8,9,10-tetrahydro-6H-cyclohepta[b][1]benzofuran-2-ylamino)-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 130278202 |
| Molecular Formula | C28H29ClN4O5 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-(7,8,9,10-tetrahydro-6H-cyclohepta[b][1]benzofuran-2-ylamino)-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@H](C)n1c(=O)nc(Nc2ccc3oc4c(c3c2)CCCCC4)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C28H29ClN4O5/c1-16(25(34)35)17(2)33-27(36)31-26(32(28(33)37)15-18-8-10-19(29)11-9-18)30-20-12-13-24-22(14-20)21-6-4-3-5-7-23(21)38-24/h8-14,16-17H,3-7,15H2,1-2H3,(H,34,35)(H,30,31,36)/t16-,17+/m1/s1 |
| InChIKey | LHJRZHYMCUGNTC-SJORKVTESA-N |
| XLogP | 5.15 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |