C29H23ClN4O3S — CID 118950640
1-(2-chlorophenyl)sulfonyl-3-[2-(3-isoquinolin-7-yl-2-pyridinyl)-2-phenylethyl]urea (PubChem CID 118950640) has the molecular formula C29H23ClN4O3S and a molecular weight of 543.05 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-3-[2-(3-isoquinolin-7-yl-2-pyridinyl)-2-phenylethyl]urea.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-3-[2-(3-isoquinolin-7-yl-2-pyridinyl)-2-phenylethyl]urea |
|---|---|
| PubChem CID | 118950640 |
| Molecular Formula | C29H23ClN4O3S |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-3-[2-(3-isoquinolin-7-yl-2-pyridinyl)-2-phenylethyl]urea |
| SMILES | O=C(NCC(c1ccccc1)c1ncccc1-c1ccc2ccncc2c1)NS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C29H23ClN4O3S/c30-26-10-4-5-11-27(26)38(36,37)34-29(35)33-19-25(21-7-2-1-3-8-21)28-24(9-6-15-32-28)22-13-12-20-14-16-31-18-23(20)17-22/h1-18,25H,19H2,(H2,33,34,35) |
| InChIKey | LXUKCANJZANIQX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |