C29H29N3O4S — CID 118950814
1-[(1R)-1-[3-(4-ethoxyphenyl)-2-pyridinyl]-2-phenylethyl]-3-(2-methylphenyl)sulfonylurea (PubChem CID 118950814) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is 1-[(1R)-1-[3-(4-ethoxyphenyl)-2-pyridinyl]-2-phenylethyl]-3-(2-methylphenyl)sulfonylurea.
| Compound Name | 1-[(1R)-1-[3-(4-ethoxyphenyl)-2-pyridinyl]-2-phenylethyl]-3-(2-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 118950814 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 1-[(1R)-1-[3-(4-ethoxyphenyl)-2-pyridinyl]-2-phenylethyl]-3-(2-methylphenyl)sulfonylurea |
| SMILES | CCOc1ccc(-c2cccnc2[C@@H](Cc2ccccc2)NC(=O)NS(=O)(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C29H29N3O4S/c1-3-36-24-17-15-23(16-18-24)25-13-9-19-30-28(25)26(20-22-11-5-4-6-12-22)31-29(33)32-37(34,35)27-14-8-7-10-21(27)2/h4-19,26H,3,20H2,1-2H3,(H2,31,32,33)/t26-/m1/s1 |
| InChIKey | HKZCKODSQWQZKX-AREMUKBSSA-N |
| XLogP | 5.43 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |