C20H20N2O4 — CID 11895309
(4-hydroxyphenyl) (3aR,9aS)-9-ethyl-2-methyl-4,9a-dihydro-3aH-furo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 11895309) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (4-hydroxyphenyl) (3aR,9aS)-9-ethyl-2-methyl-4,9a-dihydro-3aH-furo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | (4-hydroxyphenyl) (3aR,9aS)-9-ethyl-2-methyl-4,9a-dihydro-3aH-furo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 11895309 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (4-hydroxyphenyl) (3aR,9aS)-9-ethyl-2-methyl-4,9a-dihydro-3aH-furo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCN1c2ccccc2N[C@@H]2C(C(=O)Oc3ccc(O)cc3)=C(C)O[C@@H]21 |
| InChI | InChI=1S/C20H20N2O4/c1-3-22-16-7-5-4-6-15(16)21-18-17(12(2)25-19(18)22)20(24)26-14-10-8-13(23)9-11-14/h4-11,18-19,21,23H,3H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | JAONBKBJVBTOQS-MOPGFXCFSA-N |
| XLogP | 3.25 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|