C18H18N2O2 — CID 12754364
1-(11,14-dimethyl-13-oxa-11,17-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,14-hexaen-15-yl)ethanone (PubChem CID 12754364) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-(11,14-dimethyl-13-oxa-11,17-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,14-hexaen-15-yl)ethanone.
| Compound Name | 1-(11,14-dimethyl-13-oxa-11,17-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,14-hexaen-15-yl)ethanone |
|---|---|
| PubChem CID | 12754364 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-(11,14-dimethyl-13-oxa-11,17-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9,14-hexaen-15-yl)ethanone |
| SMILES | CC(=O)C1=C(C)OC2C1Nc1cc3ccccc3cc1N2C |
| InChI | InChI=1S/C18H18N2O2/c1-10(21)16-11(2)22-18-17(16)19-14-8-12-6-4-5-7-13(12)9-15(14)20(18)3/h4-9,17-19H,1-3H3 |
| InChIKey | CLWXVCCYURGFPT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |