C15H17NO2 — CID 124908960
1-[(1R,4aR,9aS)-1,3-dimethyl-1,2,4a,9a-tetrahydro-[1]benzofuro[2,3-c]pyridin-4-yl]ethanone (PubChem CID 124908960) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 1-[(1R,4aR,9aS)-1,3-dimethyl-1,2,4a,9a-tetrahydro-[1]benzofuro[2,3-c]pyridin-4-yl]ethanone.
| Compound Name | 1-[(1R,4aR,9aS)-1,3-dimethyl-1,2,4a,9a-tetrahydro-[1]benzofuro[2,3-c]pyridin-4-yl]ethanone |
|---|---|
| PubChem CID | 124908960 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-[(1R,4aR,9aS)-1,3-dimethyl-1,2,4a,9a-tetrahydro-[1]benzofuro[2,3-c]pyridin-4-yl]ethanone |
| SMILES | CC(=O)C1=C(C)N[C@H](C)[C@H]2Oc3ccccc3[C@H]12 |
| InChI | InChI=1S/C15H17NO2/c1-8-13(10(3)17)14-11-6-4-5-7-12(11)18-15(14)9(2)16-8/h4-7,9,14-16H,1-3H3/t9-,14-,15-/m1/s1 |
| InChIKey | WOGXSXGAPODTBE-DFKRKDTASA-N |
| XLogP | 2.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |