C17H14ClN5O2 — CID 118953970
2-[1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethylamino]-4-methoxypyrimidine-5-carbonitrile (PubChem CID 118953970) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is 2-[1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethylamino]-4-methoxypyrimidine-5-carbonitrile.
| Compound Name | 2-[1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethylamino]-4-methoxypyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 118953970 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[1-(6-chloro-2-oxo-1H-quinolin-3-yl)ethylamino]-4-methoxypyrimidine-5-carbonitrile |
| SMILES | COc1nc(NC(C)c2cc3cc(Cl)ccc3[nH]c2=O)ncc1C#N |
| InChI | InChI=1S/C17H14ClN5O2/c1-9(21-17-20-8-11(7-19)16(23-17)25-2)13-6-10-5-12(18)3-4-14(10)22-15(13)24/h3-6,8-9H,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | QAFWVLDKBWIXLX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |