C19H17ClN6O — CID 146222010
6-chloro-3-[1-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]ethyl]-1H-quinolin-2-one (PubChem CID 146222010) has the molecular formula C19H17ClN6O and a molecular weight of 380.84 g/mol. Its IUPAC name is 6-chloro-3-[1-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]ethyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[1-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]ethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 146222010 |
| Molecular Formula | C19H17ClN6O |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 6-chloro-3-[1-[[4-(3-methylimidazol-4-yl)pyrimidin-2-yl]amino]ethyl]-1H-quinolin-2-one |
| SMILES | CC(Nc1nccc(-c2cncn2C)n1)c1cc2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C19H17ClN6O/c1-11(14-8-12-7-13(20)3-4-15(12)24-18(14)27)23-19-22-6-5-16(25-19)17-9-21-10-26(17)2/h3-11H,1-2H3,(H,24,27)(H,22,23,25) |
| InChIKey | WPESHFWYUVZQEM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |