C16H15ClN4O3S — CID 118953989
6-chloro-3-[(1S)-1-[(4-methylsulfonylpyrimidin-2-yl)amino]ethyl]-1H-quinolin-2-one (PubChem CID 118953989) has the molecular formula C16H15ClN4O3S and a molecular weight of 378.84 g/mol. Its IUPAC name is 6-chloro-3-[(1S)-1-[(4-methylsulfonylpyrimidin-2-yl)amino]ethyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[(1S)-1-[(4-methylsulfonylpyrimidin-2-yl)amino]ethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118953989 |
| Molecular Formula | C16H15ClN4O3S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 6-chloro-3-[(1S)-1-[(4-methylsulfonylpyrimidin-2-yl)amino]ethyl]-1H-quinolin-2-one |
| SMILES | C[C@H](Nc1nccc(S(C)(=O)=O)n1)c1cc2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C16H15ClN4O3S/c1-9(19-16-18-6-5-14(21-16)25(2,23)24)12-8-10-7-11(17)3-4-13(10)20-15(12)22/h3-9H,1-2H3,(H,20,22)(H,18,19,21)/t9-/m0/s1 |
| InChIKey | JXXITMVRMCXOBH-VIFPVBQESA-N |
| XLogP | 2.55 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |