C24H18ClN5O — CID 146221783
6-chloro-3-[1-[(4-isoquinolin-4-ylpyrimidin-2-yl)amino]ethyl]-1H-quinolin-2-one (PubChem CID 146221783) has the molecular formula C24H18ClN5O and a molecular weight of 427.90 g/mol. Its IUPAC name is 6-chloro-3-[1-[(4-isoquinolin-4-ylpyrimidin-2-yl)amino]ethyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[1-[(4-isoquinolin-4-ylpyrimidin-2-yl)amino]ethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 146221783 |
| Molecular Formula | C24H18ClN5O |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 6-chloro-3-[1-[(4-isoquinolin-4-ylpyrimidin-2-yl)amino]ethyl]-1H-quinolin-2-one |
| SMILES | CC(Nc1nccc(-c2cncc3ccccc23)n1)c1cc2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C24H18ClN5O/c1-14(19-11-16-10-17(25)6-7-21(16)29-23(19)31)28-24-27-9-8-22(30-24)20-13-26-12-15-4-2-3-5-18(15)20/h2-14H,1H3,(H,29,31)(H,27,28,30) |
| InChIKey | KOIYDCSLTBXMQB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |