C22H19ClN4OS — CID 118954139
3-[(1S)-1-[(4-benzylsulfanylpyrimidin-2-yl)amino]ethyl]-6-chloro-1H-quinolin-2-one (PubChem CID 118954139) has the molecular formula C22H19ClN4OS and a molecular weight of 422.94 g/mol. Its IUPAC name is 3-[(1S)-1-[(4-benzylsulfanylpyrimidin-2-yl)amino]ethyl]-6-chloro-1H-quinolin-2-one.
| Compound Name | 3-[(1S)-1-[(4-benzylsulfanylpyrimidin-2-yl)amino]ethyl]-6-chloro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118954139 |
| Molecular Formula | C22H19ClN4OS |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-[(1S)-1-[(4-benzylsulfanylpyrimidin-2-yl)amino]ethyl]-6-chloro-1H-quinolin-2-one |
| SMILES | C[C@H](Nc1nccc(SCc2ccccc2)n1)c1cc2cc(Cl)ccc2[nH]c1=O |
| InChI | InChI=1S/C22H19ClN4OS/c1-14(18-12-16-11-17(23)7-8-19(16)26-21(18)28)25-22-24-10-9-20(27-22)29-13-15-5-3-2-4-6-15/h2-12,14H,13H2,1H3,(H,26,28)(H,24,25,27)/t14-/m0/s1 |
| InChIKey | QXUPZFJZYSVEPB-AWEZNQCLSA-N |
| XLogP | 5.44 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |