C19H23N5O2 — CID 118956464
11-[(3-methoxyphenyl)methyl]-6-propyl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (PubChem CID 118956464) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 11-[(3-methoxyphenyl)methyl]-6-propyl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one.
| Compound Name | 11-[(3-methoxyphenyl)methyl]-6-propyl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 118956464 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 11-[(3-methoxyphenyl)methyl]-6-propyl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| SMILES | CCCn1ncc2c(=O)n3c(nc21)CN(Cc1cccc(OC)c1)CC3 |
| InChI | InChI=1S/C19H23N5O2/c1-3-7-24-18-16(11-20-24)19(25)23-9-8-22(13-17(23)21-18)12-14-5-4-6-15(10-14)26-2/h4-6,10-11H,3,7-9,12-13H2,1-2H3 |
| InChIKey | WCXOYAVRYNWHTO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |