C18H20FN5O — CID 118956261
11-[(4-fluorophenyl)methyl]-6-propan-2-yl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (PubChem CID 118956261) has the molecular formula C18H20FN5O and a molecular weight of 341.39 g/mol. Its IUPAC name is 11-[(4-fluorophenyl)methyl]-6-propan-2-yl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one.
| Compound Name | 11-[(4-fluorophenyl)methyl]-6-propan-2-yl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 118956261 |
| Molecular Formula | C18H20FN5O |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 11-[(4-fluorophenyl)methyl]-6-propan-2-yl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| SMILES | CC(C)n1ncc2c(=O)n3c(nc21)CN(Cc1ccc(F)cc1)CC3 |
| InChI | InChI=1S/C18H20FN5O/c1-12(2)24-17-15(9-20-24)18(25)23-8-7-22(11-16(23)21-17)10-13-3-5-14(19)6-4-13/h3-6,9,12H,7-8,10-11H2,1-2H3 |
| InChIKey | LXROBAPSYTYSJP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |