C20H22ClN5O — CID 118956305
11-[(2-chlorophenyl)methyl]-6-cyclopentyl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (PubChem CID 118956305) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 11-[(2-chlorophenyl)methyl]-6-cyclopentyl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one.
| Compound Name | 11-[(2-chlorophenyl)methyl]-6-cyclopentyl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 118956305 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 11-[(2-chlorophenyl)methyl]-6-cyclopentyl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| SMILES | O=c1c2cnn(C3CCCC3)c2nc2n1CCN(Cc1ccccc1Cl)C2 |
| InChI | InChI=1S/C20H22ClN5O/c21-17-8-4-1-5-14(17)12-24-9-10-25-18(13-24)23-19-16(20(25)27)11-22-26(19)15-6-2-3-7-15/h1,4-5,8,11,15H,2-3,6-7,9-10,12-13H2 |
| InChIKey | RDYKJKVENNTDFN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |