C20H25N5O2 — CID 118956522
11-[(4-methoxyphenyl)methyl]-12-methyl-6-propan-2-yl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (PubChem CID 118956522) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 11-[(4-methoxyphenyl)methyl]-12-methyl-6-propan-2-yl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one.
| Compound Name | 11-[(4-methoxyphenyl)methyl]-12-methyl-6-propan-2-yl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 118956522 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 11-[(4-methoxyphenyl)methyl]-12-methyl-6-propan-2-yl-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| SMILES | COc1ccc(CN2Cc3nc4c(cnn4C(C)C)c(=O)n3CC2C)cc1 |
| InChI | InChI=1S/C20H25N5O2/c1-13(2)25-19-17(9-21-25)20(26)24-10-14(3)23(12-18(24)22-19)11-15-5-7-16(27-4)8-6-15/h5-9,13-14H,10-12H2,1-4H3 |
| InChIKey | DLSWGTITGVEBHK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |