C19H23N5O3 — CID 118956302
6-(2-methoxyethyl)-11-[(4-methoxyphenyl)methyl]-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one (PubChem CID 118956302) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 6-(2-methoxyethyl)-11-[(4-methoxyphenyl)methyl]-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one.
| Compound Name | 6-(2-methoxyethyl)-11-[(4-methoxyphenyl)methyl]-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 118956302 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 6-(2-methoxyethyl)-11-[(4-methoxyphenyl)methyl]-1,5,6,8,11-pentazatricyclo[7.4.0.03,7]trideca-3(7),4,8-trien-2-one |
| SMILES | COCCn1ncc2c(=O)n3c(nc21)CN(Cc1ccc(OC)cc1)CC3 |
| InChI | InChI=1S/C19H23N5O3/c1-26-10-9-24-18-16(11-20-24)19(25)23-8-7-22(13-17(23)21-18)12-14-3-5-15(27-2)6-4-14/h3-6,11H,7-10,12-13H2,1-2H3 |
| InChIKey | RMRSYIBFWPNHQX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |