C22H18ClFN2OS — CID 118956644
6-chloro-8-fluoro-3-[2-[3-(4-methylthiophen-3-yl)anilino]ethyl]-1H-quinolin-2-one (PubChem CID 118956644) has the molecular formula C22H18ClFN2OS and a molecular weight of 412.92 g/mol. Its IUPAC name is 6-chloro-8-fluoro-3-[2-[3-(4-methylthiophen-3-yl)anilino]ethyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-8-fluoro-3-[2-[3-(4-methylthiophen-3-yl)anilino]ethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118956644 |
| Molecular Formula | C22H18ClFN2OS |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 6-chloro-8-fluoro-3-[2-[3-(4-methylthiophen-3-yl)anilino]ethyl]-1H-quinolin-2-one |
| SMILES | Cc1cscc1-c1cccc(NCCc2cc3cc(Cl)cc(F)c3[nH]c2=O)c1 |
| InChI | InChI=1S/C22H18ClFN2OS/c1-13-11-28-12-19(13)14-3-2-4-18(9-14)25-6-5-15-7-16-8-17(23)10-20(24)21(16)26-22(15)27/h2-4,7-12,25H,5-6H2,1H3,(H,26,27) |
| InChIKey | URDDYVOKYBCRRQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |