C23H18BrF4N3O4 — CID 118957863
2-[(1S)-5-bromo-2',3,5'-trioxospiro[2H-indene-1,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 118957863) has the molecular formula C23H18BrF4N3O4 and a molecular weight of 556.31 g/mol. Its IUPAC name is 2-[(1S)-5-bromo-2',3,5'-trioxospiro[2H-indene-1,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | 2-[(1S)-5-bromo-2',3,5'-trioxospiro[2H-indene-1,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118957863 |
| Molecular Formula | C23H18BrF4N3O4 |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | 2-[(1S)-5-bromo-2',3,5'-trioxospiro[2H-indene-1,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)N[C@]2(CC(=O)c3cc(Br)ccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C23H18BrF4N3O4/c1-12(23(26,27)28)30(10-13-2-5-15(25)6-3-13)19(33)11-31-20(34)22(29-21(31)35)9-18(32)16-8-14(24)4-7-17(16)22/h2-8,12H,9-11H2,1H3,(H,29,35)/t12-,22-/m0/s1 |
| InChIKey | UCICQLJZEXBBBY-YTEVENLXSA-N |
| XLogP | 3.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|